C10H14N2OS — CID 130971562
[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3-thiazol-4-yl]methanol (PubChem CID 130971562) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is [2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 130971562 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | [2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3-thiazol-4-yl]methanol |
| SMILES | CC1=CCN(c2nc(CO)cs2)CC1 |
| InChI | InChI=1S/C10H14N2OS/c1-8-2-4-12(5-3-8)10-11-9(6-13)7-14-10/h2,7,13H,3-6H2,1H3 |
| InChIKey | CTVQEIJLDPERIN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|