C26H22N2O2S — CID 1309746
4-(2-anilino-2-oxoethyl)-5-(4-methylphenyl)-N-phenylthiophene-2-carboxamide (PubChem CID 1309746) has the molecular formula C26H22N2O2S and a molecular weight of 426.54 g/mol. Its IUPAC name is 4-(2-anilino-2-oxoethyl)-5-(4-methylphenyl)-N-phenylthiophene-2-carboxamide.
| Compound Name | 4-(2-anilino-2-oxoethyl)-5-(4-methylphenyl)-N-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 1309746 |
| Molecular Formula | C26H22N2O2S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 4-(2-anilino-2-oxoethyl)-5-(4-methylphenyl)-N-phenylthiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2sc(C(=O)Nc3ccccc3)cc2CC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N2O2S/c1-18-12-14-19(15-13-18)25-20(17-24(29)27-21-8-4-2-5-9-21)16-23(31-25)26(30)28-22-10-6-3-7-11-22/h2-16H,17H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | DALIVMUEGOULGL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |