C7H10N2O5 — CID 130979863
2-methyl-3-oxo-3-[(3-oxo-1,2-oxazolidin-4-yl)amino]propanoic acid (PubChem CID 130979863) has the molecular formula C7H10N2O5 and a molecular weight of 202.17 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-[(3-oxo-1,2-oxazolidin-4-yl)amino]propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-[(3-oxo-1,2-oxazolidin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 130979863 |
| Molecular Formula | C7H10N2O5 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-methyl-3-oxo-3-[(3-oxo-1,2-oxazolidin-4-yl)amino]propanoic acid |
| SMILES | CC(C(=O)O)C(=O)NC1CONC1=O |
| InChI | InChI=1S/C7H10N2O5/c1-3(7(12)13)5(10)8-4-2-14-9-6(4)11/h3-4H,2H2,1H3,(H,8,10)(H,9,11)(H,12,13) |
| InChIKey | GVBXLVJZGNYYJK-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|