C8H17N3O2 — CID 130984635
1-[(4-hydroxypiperidin-4-yl)methyl]-3-methylurea (PubChem CID 130984635) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-[(4-hydroxypiperidin-4-yl)methyl]-3-methylurea.
| Compound Name | 1-[(4-hydroxypiperidin-4-yl)methyl]-3-methylurea |
|---|---|
| PubChem CID | 130984635 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 1-[(4-hydroxypiperidin-4-yl)methyl]-3-methylurea |
| SMILES | CNC(=O)NCC1(O)CCNCC1 |
| InChI | InChI=1S/C8H17N3O2/c1-9-7(12)11-6-8(13)2-4-10-5-3-8/h10,13H,2-6H2,1H3,(H2,9,11,12) |
| InChIKey | NKWGUJGTWKBMOI-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |