C7H10N2O3 — CID 130987233
methyl N-[(2-methyl-1,3-oxazol-5-yl)methyl]carbamate (PubChem CID 130987233) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is methyl N-[(2-methyl-1,3-oxazol-5-yl)methyl]carbamate.
| Compound Name | methyl N-[(2-methyl-1,3-oxazol-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 130987233 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | methyl N-[(2-methyl-1,3-oxazol-5-yl)methyl]carbamate |
| SMILES | COC(=O)NCc1cnc(C)o1 |
| InChI | InChI=1S/C7H10N2O3/c1-5-8-3-6(12-5)4-9-7(10)11-2/h3H,4H2,1-2H3,(H,9,10) |
| InChIKey | HDFOWNNPHMWBNZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |