C9H13N3 — CID 130987786
3-(cyclopenten-1-ylmethyl)-4-methyl-1,2,4-triazole (PubChem CID 130987786) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-(cyclopenten-1-ylmethyl)-4-methyl-1,2,4-triazole.
| Compound Name | 3-(cyclopenten-1-ylmethyl)-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 130987786 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-(cyclopenten-1-ylmethyl)-4-methyl-1,2,4-triazole |
| SMILES | Cn1cnnc1CC1=CCCC1 |
| InChI | InChI=1S/C9H13N3/c1-12-7-10-11-9(12)6-8-4-2-3-5-8/h4,7H,2-3,5-6H2,1H3 |
| InChIKey | GVQFGYVNQPNDKD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|