C7H14N4OS — CID 130992696
3-[(3-amino-1,2,4-thiadiazol-5-yl)amino]pentan-2-ol (PubChem CID 130992696) has the molecular formula C7H14N4OS and a molecular weight of 202.28 g/mol. Its IUPAC name is 3-[(3-amino-1,2,4-thiadiazol-5-yl)amino]pentan-2-ol.
| Compound Name | 3-[(3-amino-1,2,4-thiadiazol-5-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 130992696 |
| Molecular Formula | C7H14N4OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 3-[(3-amino-1,2,4-thiadiazol-5-yl)amino]pentan-2-ol |
| SMILES | CCC(Nc1nc(N)ns1)C(C)O |
| InChI | InChI=1S/C7H14N4OS/c1-3-5(4(2)12)9-7-10-6(8)11-13-7/h4-5,12H,3H2,1-2H3,(H3,8,9,10,11) |
| InChIKey | KNCAKXNTOSIOAU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |