C9H13NO2S — CID 131015350
1-[hydroxy(1,2-thiazol-5-yl)methyl]cyclopentan-1-ol (PubChem CID 131015350) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-[hydroxy(1,2-thiazol-5-yl)methyl]cyclopentan-1-ol.
| Compound Name | 1-[hydroxy(1,2-thiazol-5-yl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 131015350 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1-[hydroxy(1,2-thiazol-5-yl)methyl]cyclopentan-1-ol |
| SMILES | OC(c1ccns1)C1(O)CCCC1 |
| InChI | InChI=1S/C9H13NO2S/c11-8(7-3-6-10-13-7)9(12)4-1-2-5-9/h3,6,8,11-12H,1-2,4-5H2 |
| InChIKey | QYEJUFXHZOBDIK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |