C12H10N4 — CID 13101569
8-methylpyrido[2,3-f]quinazolin-10-amine (PubChem CID 13101569) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is 8-methylpyrido[2,3-f]quinazolin-10-amine.
| Compound Name | 8-methylpyrido[2,3-f]quinazolin-10-amine |
|---|---|
| PubChem CID | 13101569 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 8-methylpyrido[2,3-f]quinazolin-10-amine |
| SMILES | Cc1nc(N)c2c(ccc3cccnc32)n1 |
| InChI | InChI=1S/C12H10N4/c1-7-15-9-5-4-8-3-2-6-14-11(8)10(9)12(13)16-7/h2-6H,1H3,(H2,13,15,16) |
| InChIKey | TXSXYZKVOYDYIK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|