C7H5NO2S — CID 131020703
3-(3-methyl-1,2-thiazol-5-yl)prop-2-ynoic acid (PubChem CID 131020703) has the molecular formula C7H5NO2S and a molecular weight of 167.19 g/mol. Its IUPAC name is 3-(3-methyl-1,2-thiazol-5-yl)prop-2-ynoic acid.
| Compound Name | 3-(3-methyl-1,2-thiazol-5-yl)prop-2-ynoic acid |
|---|---|
| PubChem CID | 131020703 |
| Molecular Formula | C7H5NO2S |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | 3-(3-methyl-1,2-thiazol-5-yl)prop-2-ynoic acid |
| SMILES | Cc1cc(C#CC(=O)O)sn1 |
| InChI | InChI=1S/C7H5NO2S/c1-5-4-6(11-8-5)2-3-7(9)10/h4H,1H3,(H,9,10) |
| InChIKey | OSVUMTWDWBNGMB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|