C7H7NOS — CID 130624588
3-(3-methyl-1,2-thiazol-5-yl)prop-2-yn-1-ol (PubChem CID 130624588) has the molecular formula C7H7NOS and a molecular weight of 153.21 g/mol. Its IUPAC name is 3-(3-methyl-1,2-thiazol-5-yl)prop-2-yn-1-ol.
| Compound Name | 3-(3-methyl-1,2-thiazol-5-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 130624588 |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 3-(3-methyl-1,2-thiazol-5-yl)prop-2-yn-1-ol |
| SMILES | Cc1cc(C#CCO)sn1 |
| InChI | InChI=1S/C7H7NOS/c1-6-5-7(10-8-6)3-2-4-9/h5,9H,4H2,1H3 |
| InChIKey | BKDARHJSLBMCBT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|