C5H7NS — CID 157285361
5-(deuteriomethyl)-3-methyl-1,2-thiazole (PubChem CID 157285361) has the molecular formula C5H7NS and a molecular weight of 114.19 g/mol. Its IUPAC name is 5-(deuteriomethyl)-3-methyl-1,2-thiazole.
| Compound Name | 5-(deuteriomethyl)-3-methyl-1,2-thiazole |
|---|---|
| PubChem CID | 157285361 |
| Molecular Formula | C5H7NS |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 5-(deuteriomethyl)-3-methyl-1,2-thiazole |
| SMILES | [2H]Cc1cc(C)ns1 |
| InChI | InChI=1S/C5H7NS/c1-4-3-5(2)7-6-4/h3H,1-2H3/i2D |
| InChIKey | BAEACXLWSZGCAZ-VMNATFBRSA-N |
| XLogP | 1.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |