About 4-(azetidin-2-ylmethyl)-1,4-thiazepane
4-(azetidin-2-ylmethyl)-1,4-thiazepane (PubChem CID 131023163) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 4-(azetidin-2-ylmethyl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-(azetidin-2-ylmethyl)-1,4-thiazepane |
| PubChem CID | 131023163 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-(azetidin-2-ylmethyl)-1,4-thiazepane |
| SMILES | C1CSCCN(CC2CCN2)C1 |
| InChI | InChI=1S/C9H18N2S/c1-4-11(5-7-12-6-1)8-9-2-3-10-9/h9-10H,1-8H2 |
| InChIKey | ZBOBBLBUECEKGD-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(azetidin-2-ylmethyl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-2-ylmethyl)-1,4-thiazepane?
The IUPAC name of 4-(azetidin-2-ylmethyl)-1,4-thiazepane (CID 131023163) is 4-(azetidin-2-ylmethyl)-1,4-thiazepane.
What is the SMILES notation for 4-(azetidin-2-ylmethyl)-1,4-thiazepane?
The canonical SMILES for 4-(azetidin-2-ylmethyl)-1,4-thiazepane is C1CSCCN(CC2CCN2)C1.
What is the InChIKey of 4-(azetidin-2-ylmethyl)-1,4-thiazepane?
The InChIKey is ZBOBBLBUECEKGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c1-4-11(5-7-12-6-1)8-9-2-3-10-9/h9-10H,1-8H2.
What are the key properties of 4-(azetidin-2-ylmethyl)-1,4-thiazepane?
4-(azetidin-2-ylmethyl)-1,4-thiazepane has a molecular weight of 186.32 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-2-ylmethyl)-1,4-thiazepane is sourced from PubChem (CID 131023163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).