C9H11Br2NO2 — CID 131025607
2-(2-amino-3-hydroxypropyl)-4,6-dibromophenol (PubChem CID 131025607) has the molecular formula C9H11Br2NO2 and a molecular weight of 325.00 g/mol. Its IUPAC name is 2-(2-amino-3-hydroxypropyl)-4,6-dibromophenol.
| Compound Name | 2-(2-amino-3-hydroxypropyl)-4,6-dibromophenol |
|---|---|
| PubChem CID | 131025607 |
| Molecular Formula | C9H11Br2NO2 |
| Molecular Weight | 325.00 g/mol |
| Exact Mass | 322.92 |
| IUPAC Name | 2-(2-amino-3-hydroxypropyl)-4,6-dibromophenol |
| SMILES | NC(CO)Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C9H11Br2NO2/c10-6-1-5(2-7(12)4-13)9(14)8(11)3-6/h1,3,7,13-14H,2,4,12H2 |
| InChIKey | IDZZORPIONCBSD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.00 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |