About 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol
2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol (PubChem CID 154285316) has the molecular formula C16H14Br4O3
and a molecular weight of 573.90 g/mol. Its IUPAC name is 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol.
Molecular Properties
| Compound Name | 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol |
| PubChem CID | 154285316 |
| Molecular Formula | C16H14Br4O3 |
| Molecular Weight | 573.90 g/mol |
| Exact Mass | 569.77 |
| IUPAC Name | 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1CCOCCc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C16H14Br4O3/c17-11-5-9(15(21)13(19)7-11)1-3-23-4-2-10-6-12(18)8-14(20)16(10)22/h5-8,21-22H,1-4H2 |
| InChIKey | FYTGYFIHOPZTEL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.90 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol?
The IUPAC name of 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol (CID 154285316) is 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol.
What is the SMILES notation for 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol?
The canonical SMILES for 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol is Oc1c(Br)cc(Br)cc1CCOCCc1cc(Br)cc(Br)c1O.
What is the InChIKey of 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol?
The InChIKey is FYTGYFIHOPZTEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Br4O3/c17-11-5-9(15(21)13(19)7-11)1-3-23-4-2-10-6-12(18)8-14(20)16(10)22/h5-8,21-22H,1-4H2.
What are the key properties of 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol?
2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol has a molecular weight of 573.90 g/mol, XLogP of 5.95, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-6-[2-[2-(3,5-dibromo-2-hydroxyphenyl)ethoxy]ethyl]phenol is sourced from PubChem (CID 154285316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).