C7H6Br2N2O — CID 67749909
2,4-dibromo-6-(diazenylmethyl)phenol (PubChem CID 67749909) has the molecular formula C7H6Br2N2O and a molecular weight of 293.95 g/mol. Its IUPAC name is 2,4-dibromo-6-(diazenylmethyl)phenol.
| Compound Name | 2,4-dibromo-6-(diazenylmethyl)phenol |
|---|---|
| PubChem CID | 67749909 |
| Molecular Formula | C7H6Br2N2O |
| Molecular Weight | 293.95 g/mol |
| Exact Mass | 291.88 |
| IUPAC Name | 2,4-dibromo-6-(diazenylmethyl)phenol |
| SMILES | [H]/N=N/Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C7H6Br2N2O/c8-5-1-4(3-11-10)7(12)6(9)2-5/h1-2,10,12H,3H2/b11-10+ |
| InChIKey | HTHGVXULJKSGPG-ZHACJKMWSA-N |
| XLogP | 3.45 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.95 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|