C8H7Br3O — CID 174691001
2,4-dibromo-6-(2-bromoethyl)phenol (PubChem CID 174691001) has the molecular formula C8H7Br3O and a molecular weight of 358.86 g/mol. Its IUPAC name is 2,4-dibromo-6-(2-bromoethyl)phenol.
| Compound Name | 2,4-dibromo-6-(2-bromoethyl)phenol |
|---|---|
| PubChem CID | 174691001 |
| Molecular Formula | C8H7Br3O |
| Molecular Weight | 358.86 g/mol |
| Exact Mass | 355.80 |
| IUPAC Name | 2,4-dibromo-6-(2-bromoethyl)phenol |
| SMILES | Oc1c(Br)cc(Br)cc1CCBr |
| InChI | InChI=1S/C8H7Br3O/c9-2-1-5-3-6(10)4-7(11)8(5)12/h3-4,12H,1-2H2 |
| InChIKey | VTUXFRFXUHGLGM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|