C18H18N2O6S — CID 1310310
2-(4-nitrophenyl)sulfonyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 1310310) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfonyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-(4-nitrophenyl)sulfonyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 1310310 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-(4-nitrophenyl)sulfonyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@H]1CCCO1)c1ccccc1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N2O6S/c21-18(19-12-14-4-3-11-26-14)16-5-1-2-6-17(16)27(24,25)15-9-7-13(8-10-15)20(22)23/h1-2,5-10,14H,3-4,11-12H2,(H,19,21)/t14-/m1/s1 |
| InChIKey | QCNKRCIQWCCOFZ-CQSZACIVSA-N |
| XLogP | 2.34 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|