C8H16N2O — CID 131036177
N'-[(1-hydroxycyclopentyl)methyl]ethanimidamide (PubChem CID 131036177) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is N'-[(1-hydroxycyclopentyl)methyl]ethanimidamide.
| Compound Name | N'-[(1-hydroxycyclopentyl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 131036177 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | N'-[(1-hydroxycyclopentyl)methyl]ethanimidamide |
| SMILES | C/C(N)=N\CC1(O)CCCC1 |
| InChI | InChI=1S/C8H16N2O/c1-7(9)10-6-8(11)4-2-3-5-8/h11H,2-6H2,1H3,(H2,9,10) |
| InChIKey | NIQNGRDZGQMUHO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|