C7H15N3O — CID 62407845
2-[(1-hydroxycyclopentyl)methyl]guanidine (PubChem CID 62407845) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is 2-[(1-hydroxycyclopentyl)methyl]guanidine.
| Compound Name | 2-[(1-hydroxycyclopentyl)methyl]guanidine |
|---|---|
| PubChem CID | 62407845 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 2-[(1-hydroxycyclopentyl)methyl]guanidine |
| SMILES | NC(N)=NCC1(O)CCCC1 |
| InChI | InChI=1S/C7H15N3O/c8-6(9)10-5-7(11)3-1-2-4-7/h11H,1-5H2,(H4,8,9,10) |
| InChIKey | DNNUDBNSMIKUDA-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|