C6H6ClNO2 — CID 131036937
4-(chloromethyl)-3H-pyridine-2,6-dione (PubChem CID 131036937) has the molecular formula C6H6ClNO2 and a molecular weight of 159.57 g/mol. Its IUPAC name is 4-(chloromethyl)-3H-pyridine-2,6-dione.
| Compound Name | 4-(chloromethyl)-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 131036937 |
| Molecular Formula | C6H6ClNO2 |
| Molecular Weight | 159.57 g/mol |
| Exact Mass | 159.01 |
| IUPAC Name | 4-(chloromethyl)-3H-pyridine-2,6-dione |
| SMILES | O=C1C=C(CCl)CC(=O)N1 |
| InChI | InChI=1S/C6H6ClNO2/c7-3-4-1-5(9)8-6(10)2-4/h1H,2-3H2,(H,8,9,10) |
| InChIKey | KEGROHHMOGXKPE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.57 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|