C20H25Cl2N2O2P — CID 13103960
N-[(2,2-dichloro-1-phenylethenoxy)-ethoxy-phenylimino-λ5-phosphanyl]-N-ethylethanamine (PubChem CID 13103960) has the molecular formula C20H25Cl2N2O2P and a molecular weight of 427.31 g/mol. Its IUPAC name is N-[(2,2-dichloro-1-phenylethenoxy)-ethoxy-phenylimino-λ5-phosphanyl]-N-ethylethanamine.
| Compound Name | N-[(2,2-dichloro-1-phenylethenoxy)-ethoxy-phenylimino-λ5-phosphanyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 13103960 |
| Molecular Formula | C20H25Cl2N2O2P |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[(2,2-dichloro-1-phenylethenoxy)-ethoxy-phenylimino-λ5-phosphanyl]-N-ethylethanamine |
| SMILES | CCOP(=Nc1ccccc1)(OC(=C(Cl)Cl)c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C20H25Cl2N2O2P/c1-4-24(5-2)27(25-6-3,23-18-15-11-8-12-16-18)26-19(20(21)22)17-13-9-7-10-14-17/h7-16H,4-6H2,1-3H3 |
| InChIKey | OGNLCVVBZBHNML-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|