C23H25N2O2P — CID 13407637
1-[diethoxy(phenylimino)-lambda5-phosphanyl]-N,1-diphenylmethanimine (PubChem CID 13407637) has the molecular formula C23H25N2O2P and a molecular weight of 392.44 g/mol. Its IUPAC name is 1-[diethoxy(phenylimino)-lambda5-phosphanyl]-N,1-diphenylmethanimine.
| Compound Name | 1-[diethoxy(phenylimino)-lambda5-phosphanyl]-N,1-diphenylmethanimine |
|---|---|
| PubChem CID | 13407637 |
| Molecular Formula | C23H25N2O2P |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[diethoxy(phenylimino)-lambda5-phosphanyl]-N,1-diphenylmethanimine |
| SMILES | CCOP(=Nc1ccccc1)(OCC)/C(=N\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25N2O2P/c1-3-26-28(27-4-2,25-22-18-12-7-13-19-22)23(20-14-8-5-9-15-20)24-21-16-10-6-11-17-21/h5-19H,3-4H2,1-2H3/b24-23- |
| InChIKey | UUUBYONHODTKPX-VHXPQNKSSA-N |
| XLogP | 7.20 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|