C21H33N3O4P2 — CID 23265155
N,N-bis[diethoxy(phenylimino)-λ5-phosphanyl]methanamine (PubChem CID 23265155) has the molecular formula C21H33N3O4P2 and a molecular weight of 453.46 g/mol. Its IUPAC name is N,N-bis[diethoxy(phenylimino)-λ5-phosphanyl]methanamine.
| Compound Name | N,N-bis[diethoxy(phenylimino)-λ5-phosphanyl]methanamine |
|---|---|
| PubChem CID | 23265155 |
| Molecular Formula | C21H33N3O4P2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N,N-bis[diethoxy(phenylimino)-λ5-phosphanyl]methanamine |
| SMILES | CCOP(=Nc1ccccc1)(OCC)N(C)P(=Nc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C21H33N3O4P2/c1-6-25-29(26-7-2,22-20-16-12-10-13-17-20)24(5)30(27-8-3,28-9-4)23-21-18-14-11-15-19-21/h10-19H,6-9H2,1-5H3 |
| InChIKey | FEQJTGBTSNGWET-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 64.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|