C16H23ClNO3P — CID 23264979
(2-chlorocyclohexen-1-yl)oxy-diethoxy-phenylimino-λ5-phosphane (PubChem CID 23264979) has the molecular formula C16H23ClNO3P and a molecular weight of 343.79 g/mol. Its IUPAC name is (2-chlorocyclohexen-1-yl)oxy-diethoxy-phenylimino-λ5-phosphane.
| Compound Name | (2-chlorocyclohexen-1-yl)oxy-diethoxy-phenylimino-λ5-phosphane |
|---|---|
| PubChem CID | 23264979 |
| Molecular Formula | C16H23ClNO3P |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (2-chlorocyclohexen-1-yl)oxy-diethoxy-phenylimino-λ5-phosphane |
| SMILES | CCOP(=Nc1ccccc1)(OCC)OC1=C(Cl)CCCC1 |
| InChI | InChI=1S/C16H23ClNO3P/c1-3-19-22(20-4-2,18-14-10-6-5-7-11-14)21-16-13-9-8-12-15(16)17/h5-7,10-11H,3-4,8-9,12-13H2,1-2H3 |
| InChIKey | ZDSJTEPORQSEDY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|