C20H31F3N3O3P — CID 134881069
ethyl (E)-3-[bis(diethylamino)-phenylimino-λ5-phosphanyl]oxy-4,4,4-trifluorobut-2-enoate (PubChem CID 134881069) has the molecular formula C20H31F3N3O3P and a molecular weight of 449.45 g/mol. Its IUPAC name is ethyl (E)-3-[bis(diethylamino)-phenylimino-λ5-phosphanyl]oxy-4,4,4-trifluorobut-2-enoate.
| Compound Name | ethyl (E)-3-[bis(diethylamino)-phenylimino-λ5-phosphanyl]oxy-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 134881069 |
| Molecular Formula | C20H31F3N3O3P |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | ethyl (E)-3-[bis(diethylamino)-phenylimino-λ5-phosphanyl]oxy-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(/OP(=Nc1ccccc1)(N(CC)CC)N(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C20H31F3N3O3P/c1-6-25(7-2)30(26(8-3)9-4,24-17-14-12-11-13-15-17)29-18(20(21,22)23)16-19(27)28-10-5/h11-16H,6-10H2,1-5H3/b18-16+ |
| InChIKey | PZXCKLAGPCLOJA-FBMGVBCBSA-N |
| XLogP | 5.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|