C9H14N2OS — CID 131043174
N-[1-(methoxymethyl)cyclobutyl]-1,3-thiazol-2-amine (PubChem CID 131043174) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is N-[1-(methoxymethyl)cyclobutyl]-1,3-thiazol-2-amine.
| Compound Name | N-[1-(methoxymethyl)cyclobutyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 131043174 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N-[1-(methoxymethyl)cyclobutyl]-1,3-thiazol-2-amine |
| SMILES | COCC1(Nc2nccs2)CCC1 |
| InChI | InChI=1S/C9H14N2OS/c1-12-7-9(3-2-4-9)11-8-10-5-6-13-8/h5-6H,2-4,7H2,1H3,(H,10,11) |
| InChIKey | XRGJHRZPAZPZFG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |