C10H15N3S — CID 131049252
4-N-(2-methylthiolan-3-yl)pyridine-2,4-diamine (PubChem CID 131049252) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 4-N-(2-methylthiolan-3-yl)pyridine-2,4-diamine.
| Compound Name | 4-N-(2-methylthiolan-3-yl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 131049252 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 4-N-(2-methylthiolan-3-yl)pyridine-2,4-diamine |
| SMILES | CC1SCCC1Nc1ccnc(N)c1 |
| InChI | InChI=1S/C10H15N3S/c1-7-9(3-5-14-7)13-8-2-4-12-10(11)6-8/h2,4,6-7,9H,3,5H2,1H3,(H3,11,12,13) |
| InChIKey | OSCYETJIXOTIDC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |