C8H14O4S — CID 131050449
3-(2-hydroxypropyl)-1,1-dioxothiolane-3-carbaldehyde (PubChem CID 131050449) has the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. Its IUPAC name is 3-(2-hydroxypropyl)-1,1-dioxothiolane-3-carbaldehyde.
| Compound Name | 3-(2-hydroxypropyl)-1,1-dioxothiolane-3-carbaldehyde |
|---|---|
| PubChem CID | 131050449 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3-(2-hydroxypropyl)-1,1-dioxothiolane-3-carbaldehyde |
| SMILES | CC(O)CC1(C=O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14O4S/c1-7(10)4-8(5-9)2-3-13(11,12)6-8/h5,7,10H,2-4,6H2,1H3 |
| InChIKey | AGKGSDHBADXJOI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|