C19H26N2O3S — CID 13106303
2-methyl-5-[2-[1-(2-methylphenoxy)propan-2-ylamino]ethyl]benzenesulfonamide (PubChem CID 13106303) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-methyl-5-[2-[1-(2-methylphenoxy)propan-2-ylamino]ethyl]benzenesulfonamide.
| Compound Name | 2-methyl-5-[2-[1-(2-methylphenoxy)propan-2-ylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 13106303 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-methyl-5-[2-[1-(2-methylphenoxy)propan-2-ylamino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccccc1OCC(C)NCCc1ccc(C)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C19H26N2O3S/c1-14-6-4-5-7-18(14)24-13-16(3)21-11-10-17-9-8-15(2)19(12-17)25(20,22)23/h4-9,12,16,21H,10-11,13H2,1-3H3,(H2,20,22,23) |
| InChIKey | AESBTJUTEAXINP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |