C16H19NO4S2 — CID 90685872
5-[3-(benzenesulfonyl)propyl]-2-methylbenzenesulfonamide (PubChem CID 90685872) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 5-[3-(benzenesulfonyl)propyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-[3-(benzenesulfonyl)propyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90685872 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 5-[3-(benzenesulfonyl)propyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(CCCS(=O)(=O)c2ccccc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H19NO4S2/c1-13-9-10-14(12-16(13)23(17,20)21)6-5-11-22(18,19)15-7-3-2-4-8-15/h2-4,7-10,12H,5-6,11H2,1H3,(H2,17,20,21) |
| InChIKey | LIBGQKRJAUHRNT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |