C11H16O3 — CID 131065434
(4aR,5S,8R,8aS)-5-hydroxy-8-methoxy-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one (PubChem CID 131065434) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (4aR,5S,8R,8aS)-5-hydroxy-8-methoxy-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one.
| Compound Name | (4aR,5S,8R,8aS)-5-hydroxy-8-methoxy-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 131065434 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (4aR,5S,8R,8aS)-5-hydroxy-8-methoxy-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one |
| SMILES | CO[C@@H]1CC[C@H](O)[C@@H]2C=CC(=O)C[C@@H]21 |
| InChI | InChI=1S/C11H16O3/c1-14-11-5-4-10(13)8-3-2-7(12)6-9(8)11/h2-3,8-11,13H,4-6H2,1H3/t8-,9+,10+,11-/m1/s1 |
| InChIKey | SPQPUEFUEXMCTE-VPOLOUISSA-N |
| XLogP | 0.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |