C14H11NO4 — CID 46914397
2-[(1R,2R)-2-hydroxy-5-oxocyclohex-3-en-1-yl]isoindole-1,3-dione (PubChem CID 46914397) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-[(1R,2R)-2-hydroxy-5-oxocyclohex-3-en-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2R)-2-hydroxy-5-oxocyclohex-3-en-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46914397 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-[(1R,2R)-2-hydroxy-5-oxocyclohex-3-en-1-yl]isoindole-1,3-dione |
| SMILES | O=C1C=C[C@@H](O)[C@H](N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C14H11NO4/c16-8-5-6-12(17)11(7-8)15-13(18)9-3-1-2-4-10(9)14(15)19/h1-6,11-12,17H,7H2/t11-,12-/m1/s1 |
| InChIKey | RRUSTRIJXZXVBM-VXGBXAGGSA-N |
| XLogP | 0.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|