C15H18N2O5S — CID 59827282
(2R,5S,6S)-5-(1,3-dioxoisoindol-2-yl)-6-hydroxy-2-methylazepane-1-sulfinic acid (PubChem CID 59827282) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is (2R,5S,6S)-5-(1,3-dioxoisoindol-2-yl)-6-hydroxy-2-methylazepane-1-sulfinic acid.
| Compound Name | (2R,5S,6S)-5-(1,3-dioxoisoindol-2-yl)-6-hydroxy-2-methylazepane-1-sulfinic acid |
|---|---|
| PubChem CID | 59827282 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2R,5S,6S)-5-(1,3-dioxoisoindol-2-yl)-6-hydroxy-2-methylazepane-1-sulfinic acid |
| SMILES | C[C@@H]1CC[C@H](N2C(=O)c3ccccc3C2=O)[C@@H](O)CN1S(=O)O |
| InChI | InChI=1S/C15H18N2O5S/c1-9-6-7-12(13(18)8-16(9)23(21)22)17-14(19)10-4-2-3-5-11(10)15(17)20/h2-5,9,12-13,18H,6-8H2,1H3,(H,21,22)/t9-,12+,13+/m1/s1 |
| InChIKey | UZNWSINFUZPEKU-ICCXJUOJSA-N |
| XLogP | 0.63 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|