C9H10F2O2 — CID 131073312
3-(difluoromethoxy)-4,5-dimethylphenol (PubChem CID 131073312) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 3-(difluoromethoxy)-4,5-dimethylphenol.
| Compound Name | 3-(difluoromethoxy)-4,5-dimethylphenol |
|---|---|
| PubChem CID | 131073312 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-(difluoromethoxy)-4,5-dimethylphenol |
| SMILES | Cc1cc(O)cc(OC(F)F)c1C |
| InChI | InChI=1S/C9H10F2O2/c1-5-3-7(12)4-8(6(5)2)13-9(10)11/h3-4,9,12H,1-2H3 |
| InChIKey | ZXDYTAPTDZASFN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |