C9H16N2O2 — CID 131081683
(4aS,8aR)-7-ethyl-4,4a,5,6,8,8a-hexahydro-1H-pyrido[3,4-d][1,3]oxazin-2-one (PubChem CID 131081683) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (4aS,8aR)-7-ethyl-4,4a,5,6,8,8a-hexahydro-1H-pyrido[3,4-d][1,3]oxazin-2-one.
| Compound Name | (4aS,8aR)-7-ethyl-4,4a,5,6,8,8a-hexahydro-1H-pyrido[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 131081683 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (4aS,8aR)-7-ethyl-4,4a,5,6,8,8a-hexahydro-1H-pyrido[3,4-d][1,3]oxazin-2-one |
| SMILES | CCN1CC[C@@H]2COC(=O)N[C@H]2C1 |
| InChI | InChI=1S/C9H16N2O2/c1-2-11-4-3-7-6-13-9(12)10-8(7)5-11/h7-8H,2-6H2,1H3,(H,10,12)/t7-,8+/m1/s1 |
| InChIKey | YURBQZATOQCYTO-SFYZADRCSA-N |
| XLogP | 0.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |