C9H14N2O4 — CID 67033891
4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid (PubChem CID 67033891) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid.
| Compound Name | 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67033891 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid |
| SMILES | O=C1NC(C2CCN(C(=O)O)CC2)CO1 |
| InChI | InChI=1S/C9H14N2O4/c12-8-10-7(5-15-8)6-1-3-11(4-2-6)9(13)14/h6-7H,1-5H2,(H,10,12)(H,13,14) |
| InChIKey | VEYIVMHDPGELHV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |