4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid

C9H14N2O4 — CID 67033891

IUPAC4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid
SMILESO=C1NC(C2CCN(C(=O)O)CC2)CO1
InChIInChI=1S/C9H14N2O4/c12-8-10-7(5-15-8)6-1-3-11(4-2-6)9(13)14/h6-7H,1-5H2,(H,10,12)(H,13,14)
InChIKeyVEYIVMHDPGELHV-UHFFFAOYSA-N
MW214.22 g/mol
LogP0.48
Rot. Bonds1

About 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid

4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid (PubChem CID 67033891) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid.

Molecular Properties

Compound Name4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid
PubChem CID67033891
Molecular FormulaC9H14N2O4
Molecular Weight214.22 g/mol
Exact Mass214.10
IUPAC Name4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid
SMILESO=C1NC(C2CCN(C(=O)O)CC2)CO1
InChIInChI=1S/C9H14N2O4/c12-8-10-7(5-15-8)6-1-3-11(4-2-6)9(13)14/h6-7H,1-5H2,(H,10,12)(H,13,14)
InChIKeyVEYIVMHDPGELHV-UHFFFAOYSA-N
XLogP0.48
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.22
LogP ≤ 50.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid?
The IUPAC name of 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid (CID 67033891) is 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid.
What is the SMILES notation for 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid?
The canonical SMILES for 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid is O=C1NC(C2CCN(C(=O)O)CC2)CO1.
What is the InChIKey of 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid?
The InChIKey is VEYIVMHDPGELHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4/c12-8-10-7(5-15-8)6-1-3-11(4-2-6)9(13)14/h6-7H,1-5H2,(H,10,12)(H,13,14).
What are the key properties of 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid?
4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid has a molecular weight of 214.22 g/mol, XLogP of 0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxo-1,3-oxazolidin-4-yl)piperidine-1-carboxylic acid is sourced from PubChem (CID 67033891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).