C17H20N4O5 — CID 167962401
2-[(4aS,8aS)-2-oxo-4,4a,5,7,8,8a-hexahydro-1H-pyrido[4,3-d][1,3]oxazin-6-yl]-N-(4-acetamidophenyl)-2-oxoacetamide (PubChem CID 167962401) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[(4aS,8aS)-2-oxo-4,4a,5,7,8,8a-hexahydro-1H-pyrido[4,3-d][1,3]oxazin-6-yl]-N-(4-acetamidophenyl)-2-oxoacetamide.
| Compound Name | 2-[(4aS,8aS)-2-oxo-4,4a,5,7,8,8a-hexahydro-1H-pyrido[4,3-d][1,3]oxazin-6-yl]-N-(4-acetamidophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 167962401 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-[(4aS,8aS)-2-oxo-4,4a,5,7,8,8a-hexahydro-1H-pyrido[4,3-d][1,3]oxazin-6-yl]-N-(4-acetamidophenyl)-2-oxoacetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(=O)N2CC[C@@H]3NC(=O)OC[C@H]3C2)cc1 |
| InChI | InChI=1S/C17H20N4O5/c1-10(22)18-12-2-4-13(5-3-12)19-15(23)16(24)21-7-6-14-11(8-21)9-26-17(25)20-14/h2-5,11,14H,6-9H2,1H3,(H,18,22)(H,19,23)(H,20,25)/t11-,14+/m1/s1 |
| InChIKey | SGSMATPRZAWKIM-RISCZKNCSA-N |
| XLogP | 0.54 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|