C6H10N2O2 — CID 115011464
4,4a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-d][1,3]oxazin-2-one (PubChem CID 115011464) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 4,4a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-d][1,3]oxazin-2-one.
| Compound Name | 4,4a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 115011464 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 4,4a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-d][1,3]oxazin-2-one |
| SMILES | O=C1NC2CNCC2CO1 |
| InChI | InChI=1S/C6H10N2O2/c9-6-8-5-2-7-1-4(5)3-10-6/h4-5,7H,1-3H2,(H,8,9) |
| InChIKey | AHZWKKKMTFKVAA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |