C10H21N3 — CID 131096617
1-[(1S)-1-cyclopentylethyl]-2,3-dimethylguanidine (PubChem CID 131096617) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 1-[(1S)-1-cyclopentylethyl]-2,3-dimethylguanidine.
| Compound Name | 1-[(1S)-1-cyclopentylethyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 131096617 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 1-[(1S)-1-cyclopentylethyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)N[C@@H](C)C1CCCC1 |
| InChI | InChI=1S/C10H21N3/c1-8(9-6-4-5-7-9)13-10(11-2)12-3/h8-9H,4-7H2,1-3H3,(H2,11,12,13)/t8-/m0/s1 |
| InChIKey | XXDDKUFGYIVYPN-QMMMGPOBSA-N |
| XLogP | 1.36 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|