C7H10N2O2 — CID 131107074
(3aS,4S,5R,7aS)-3a,4,5,7a-tetrahydro-3H-indazole-4,5-diol (PubChem CID 131107074) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is (3aS,4S,5R,7aS)-3a,4,5,7a-tetrahydro-3H-indazole-4,5-diol.
| Compound Name | (3aS,4S,5R,7aS)-3a,4,5,7a-tetrahydro-3H-indazole-4,5-diol |
|---|---|
| PubChem CID | 131107074 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | (3aS,4S,5R,7aS)-3a,4,5,7a-tetrahydro-3H-indazole-4,5-diol |
| SMILES | O[C@H]1[C@H]2CN=N[C@H]2C=C[C@H]1O |
| InChI | InChI=1S/C7H10N2O2/c10-6-2-1-5-4(7(6)11)3-8-9-5/h1-2,4-7,10-11H,3H2/t4-,5-,6+,7-/m0/s1 |
| InChIKey | ZSWJYXAKZHNWJF-YTLHQDLWSA-N |
| XLogP | -0.27 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|