C9H18N2S2 — CID 131113507
3-(6-methyl-1,4-thiazepan-4-yl)propanethioamide (PubChem CID 131113507) has the molecular formula C9H18N2S2 and a molecular weight of 218.39 g/mol. Its IUPAC name is 3-(6-methyl-1,4-thiazepan-4-yl)propanethioamide.
| Compound Name | 3-(6-methyl-1,4-thiazepan-4-yl)propanethioamide |
|---|---|
| PubChem CID | 131113507 |
| Molecular Formula | C9H18N2S2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-(6-methyl-1,4-thiazepan-4-yl)propanethioamide |
| SMILES | CC1CSCCN(CCC(N)=S)C1 |
| InChI | InChI=1S/C9H18N2S2/c1-8-6-11(3-2-9(10)12)4-5-13-7-8/h8H,2-7H2,1H3,(H2,10,12) |
| InChIKey | LKEFJCCOVJTDGU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|