C8H16BrNS — CID 130820239
4-(2-bromoethyl)-6-methyl-1,4-thiazepane (PubChem CID 130820239) has the molecular formula C8H16BrNS and a molecular weight of 238.19 g/mol. Its IUPAC name is 4-(2-bromoethyl)-6-methyl-1,4-thiazepane.
| Compound Name | 4-(2-bromoethyl)-6-methyl-1,4-thiazepane |
|---|---|
| PubChem CID | 130820239 |
| Molecular Formula | C8H16BrNS |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 4-(2-bromoethyl)-6-methyl-1,4-thiazepane |
| SMILES | CC1CSCCN(CCBr)C1 |
| InChI | InChI=1S/C8H16BrNS/c1-8-6-10(3-2-9)4-5-11-7-8/h8H,2-7H2,1H3 |
| InChIKey | WEGDCIGOZCCUJN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|