C8H19NS — CID 91460032
3,5-dimethyl-1,3-thiazinane;ethane (PubChem CID 91460032) has the molecular formula C8H19NS and a molecular weight of 161.31 g/mol. Its IUPAC name is 3,5-dimethyl-1,3-thiazinane;ethane.
| Compound Name | 3,5-dimethyl-1,3-thiazinane;ethane |
|---|---|
| PubChem CID | 91460032 |
| Molecular Formula | C8H19NS |
| Molecular Weight | 161.31 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3,5-dimethyl-1,3-thiazinane;ethane |
| SMILES | CC.CC1CSCN(C)C1 |
| InChI | InChI=1S/C6H13NS.C2H6/c1-6-3-7(2)5-8-4-6;1-2/h6H,3-5H2,1-2H3;1-2H3 |
| InChIKey | VNFMAPVBYPEEAG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |