C6H11NS2 — CID 151175110
3,5-dimethyl-1,3-thiazinane-6-thione (PubChem CID 151175110) has the molecular formula C6H11NS2 and a molecular weight of 161.29 g/mol. Its IUPAC name is 3,5-dimethyl-1,3-thiazinane-6-thione.
| Compound Name | 3,5-dimethyl-1,3-thiazinane-6-thione |
|---|---|
| PubChem CID | 151175110 |
| Molecular Formula | C6H11NS2 |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 3,5-dimethyl-1,3-thiazinane-6-thione |
| SMILES | CC1CN(C)CSC1=S |
| InChI | InChI=1S/C6H11NS2/c1-5-3-7(2)4-9-6(5)8/h5H,3-4H2,1-2H3 |
| InChIKey | NDCKNDSJHYJFHQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|