C9H17N3O — CID 131114990
N-(1,5-diazabicyclo[3.2.2]nonan-6-ylmethyl)formamide (PubChem CID 131114990) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is N-(1,5-diazabicyclo[3.2.2]nonan-6-ylmethyl)formamide.
| Compound Name | N-(1,5-diazabicyclo[3.2.2]nonan-6-ylmethyl)formamide |
|---|---|
| PubChem CID | 131114990 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-(1,5-diazabicyclo[3.2.2]nonan-6-ylmethyl)formamide |
| SMILES | O=CNCC1CN2CCCN1CC2 |
| InChI | InChI=1S/C9H17N3O/c13-8-10-6-9-7-11-2-1-3-12(9)5-4-11/h8-9H,1-7H2,(H,10,13) |
| InChIKey | IEIHULHVUDYUEQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|