C9H18N2O2 — CID 131123001
(3S,6S)-6-amino-3-propan-2-yl-1,4-oxazocan-5-one (PubChem CID 131123001) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3S,6S)-6-amino-3-propan-2-yl-1,4-oxazocan-5-one.
| Compound Name | (3S,6S)-6-amino-3-propan-2-yl-1,4-oxazocan-5-one |
|---|---|
| PubChem CID | 131123001 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (3S,6S)-6-amino-3-propan-2-yl-1,4-oxazocan-5-one |
| SMILES | CC(C)[C@H]1COCC[C@H](N)C(=O)N1 |
| InChI | InChI=1S/C9H18N2O2/c1-6(2)8-5-13-4-3-7(10)9(12)11-8/h6-8H,3-5,10H2,1-2H3,(H,11,12)/t7-,8+/m0/s1 |
| InChIKey | IPJIXZFHKHZGAU-JGVFFNPUSA-N |
| XLogP | -0.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |