C7H11NO4 — CID 131124075
(1S,2S,5S,6S)-2-methoxy-3,7-dioxabicyclo[4.1.0]heptane-5-carboxamide (PubChem CID 131124075) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is (1S,2S,5S,6S)-2-methoxy-3,7-dioxabicyclo[4.1.0]heptane-5-carboxamide.
| Compound Name | (1S,2S,5S,6S)-2-methoxy-3,7-dioxabicyclo[4.1.0]heptane-5-carboxamide |
|---|---|
| PubChem CID | 131124075 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (1S,2S,5S,6S)-2-methoxy-3,7-dioxabicyclo[4.1.0]heptane-5-carboxamide |
| SMILES | CO[C@H]1OC[C@H](C(N)=O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C7H11NO4/c1-10-7-5-4(12-5)3(2-11-7)6(8)9/h3-5,7H,2H2,1H3,(H2,8,9)/t3-,4-,5-,7-/m0/s1 |
| InChIKey | PWUPYHYRMUJIQL-FZTZQNQQSA-N |
| XLogP | -1.14 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|