C6H10O5S2 — CID 13115090
1,1,3,3-tetraoxo-1,3-dithiocan-5-one (PubChem CID 13115090) has the molecular formula C6H10O5S2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1,1,3,3-tetraoxo-1,3-dithiocan-5-one.
| Compound Name | 1,1,3,3-tetraoxo-1,3-dithiocan-5-one |
|---|---|
| PubChem CID | 13115090 |
| Molecular Formula | C6H10O5S2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 1,1,3,3-tetraoxo-1,3-dithiocan-5-one |
| SMILES | O=C1CCCS(=O)(=O)CS(=O)(=O)C1 |
| InChI | InChI=1S/C6H10O5S2/c7-6-2-1-3-12(8,9)5-13(10,11)4-6/h1-5H2 |
| InChIKey | UPVNOIGASRDQCA-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |