2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid

C7H9FO4S — CID 79729832

IUPAC2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid
SMILESO=C(O)C(F)=C1CCCS(=O)(=O)C1
InChIInChI=1S/C7H9FO4S/c8-6(7(9)10)5-2-1-3-13(11,12)4-5/h1-4H2,(H,9,10)
InChIKeyCRXKOHPFPZCPSO-UHFFFAOYSA-N
MW208.21 g/mol
LogP0.50
Rot. Bonds1

About 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid

2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid (PubChem CID 79729832) has the molecular formula C7H9FO4S and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid.

Molecular Properties

Compound Name2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid
PubChem CID79729832
Molecular FormulaC7H9FO4S
Molecular Weight208.21 g/mol
Exact Mass208.02
IUPAC Name2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid
SMILESO=C(O)C(F)=C1CCCS(=O)(=O)C1
InChIInChI=1S/C7H9FO4S/c8-6(7(9)10)5-2-1-3-13(11,12)4-5/h1-4H2,(H,9,10)
InChIKeyCRXKOHPFPZCPSO-UHFFFAOYSA-N
XLogP0.50
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.21
LogP ≤ 50.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid?
The IUPAC name of 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid (CID 79729832) is 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid.
What is the SMILES notation for 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid?
The canonical SMILES for 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid is O=C(O)C(F)=C1CCCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid?
The InChIKey is CRXKOHPFPZCPSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FO4S/c8-6(7(9)10)5-2-1-3-13(11,12)4-5/h1-4H2,(H,9,10).
What are the key properties of 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid?
2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid has a molecular weight of 208.21 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothian-3-ylidene)-2-fluoroacetic acid is sourced from PubChem (CID 79729832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).